C25H25F2N3O6 — CID 25253499
methyl 4-[[6-(2,2-difluoroethoxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]benzoate (PubChem CID 25253499) has the molecular formula C25H25F2N3O6 and a molecular weight of 501.49 g/mol. Its IUPAC name is methyl 4-[[6-(2,2-difluoroethoxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]benzoate.
| Compound Name | methyl 4-[[6-(2,2-difluoroethoxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 25253499 |
| Molecular Formula | C25H25F2N3O6 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | methyl 4-[[6-(2,2-difluoroethoxy)-1-(1-formylpiperidin-4-yl)-2,4-dioxoquinazolin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2c(=O)c3cc(OCC(F)F)ccc3n(C3CCN(C=O)CC3)c2=O)cc1 |
| InChI | InChI=1S/C25H25F2N3O6/c1-35-24(33)17-4-2-16(3-5-17)13-29-23(32)20-12-19(36-14-22(26)27)6-7-21(20)30(25(29)34)18-8-10-28(15-31)11-9-18/h2-7,12,15,18,22H,8-11,13-14H2,1H3 |
| InChIKey | ZHRLOAJOWDEURC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|