C28H33N3O — CID 25253636
4-(aminomethyl)-N-[1-[3-(3-aminophenyl)phenyl]-2-phenylethyl]cyclohexane-1-carboxamide (PubChem CID 25253636) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-[3-(3-aminophenyl)phenyl]-2-phenylethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[1-[3-(3-aminophenyl)phenyl]-2-phenylethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 25253636 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 4-(aminomethyl)-N-[1-[3-(3-aminophenyl)phenyl]-2-phenylethyl]cyclohexane-1-carboxamide |
| SMILES | NCC1CCC(C(=O)NC(Cc2ccccc2)c2cccc(-c3cccc(N)c3)c2)CC1 |
| InChI | InChI=1S/C28H33N3O/c29-19-21-12-14-22(15-13-21)28(32)31-27(16-20-6-2-1-3-7-20)25-10-4-8-23(17-25)24-9-5-11-26(30)18-24/h1-11,17-18,21-22,27H,12-16,19,29-30H2,(H,31,32) |
| InChIKey | IETKLXCURMLPOS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|