C29H33N3O3 — CID 25254573
2-amino-5-[3-[1-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-2-phenylethyl]phenyl]benzoic acid (PubChem CID 25254573) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-amino-5-[3-[1-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-2-phenylethyl]phenyl]benzoic acid.
| Compound Name | 2-amino-5-[3-[1-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-2-phenylethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 25254573 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 2-amino-5-[3-[1-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-2-phenylethyl]phenyl]benzoic acid |
| SMILES | NCC1CCC(C(=O)NC(Cc2ccccc2)c2cccc(-c3ccc(N)c(C(=O)O)c3)c2)CC1 |
| InChI | InChI=1S/C29H33N3O3/c30-18-20-9-11-21(12-10-20)28(33)32-27(15-19-5-2-1-3-6-19)24-8-4-7-22(16-24)23-13-14-26(31)25(17-23)29(34)35/h1-8,13-14,16-17,20-21,27H,9-12,15,18,30-31H2,(H,32,33)(H,34,35) |
| InChIKey | ACQOBCWZIXSQAF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|