C33H34F6N6O3 — CID 159098762
N-[1-[3-amino-5-(3-amino-1H-indazol-6-yl)phenyl]-2-phenylethyl]-4-(aminomethyl)cyclohexane-1-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159098762) has the molecular formula C33H34F6N6O3 and a molecular weight of 676.66 g/mol. Its IUPAC name is N-[1-[3-amino-5-(3-amino-1H-indazol-6-yl)phenyl]-2-phenylethyl]-4-(aminomethyl)cyclohexane-1-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-[1-[3-amino-5-(3-amino-1H-indazol-6-yl)phenyl]-2-phenylethyl]-4-(aminomethyl)cyclohexane-1-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159098762 |
| Molecular Formula | C33H34F6N6O3 |
| Molecular Weight | 676.66 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | N-[1-[3-amino-5-(3-amino-1H-indazol-6-yl)phenyl]-2-phenylethyl]-4-(aminomethyl)cyclohexane-1-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | NCC1CCC(C(=O)NC(Cc2ccccc2)c2cc(N)cc(-c3ccc4c(N)n[nH]c4c3)c2)CC1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H34N6O.C4F6O2/c30-17-19-6-8-20(9-7-19)29(36)33-26(12-18-4-2-1-3-5-18)23-13-22(14-24(31)15-23)21-10-11-25-27(16-21)34-35-28(25)32;5-3(6,7)1(11)2(12)4(8,9)10/h1-5,10-11,13-16,19-20,26H,6-9,12,17,30-31H2,(H,33,36)(H3,32,34,35); |
| InChIKey | KCZUNMQYOJNWDV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|