C31H35NO10 — CID 25254534
(2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl (5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate (PubChem CID 25254534) has the molecular formula C31H35NO10 and a molecular weight of 581.62 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl (5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate.
| Compound Name | (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl (5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 25254534 |
| Molecular Formula | C31H35NO10 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;ethyl (5R)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@H]2CCC1N2C.Cc1ccc(C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H18O8.C11H17NO2/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;1-3-14-11(13)9-6-4-8-5-7-10(9)12(8)2/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);6,8,10H,3-5,7H2,1-2H3/t15-,16-;8-,10?/m10/s1 |
| InChIKey | MDJXBIBYHKNBNF-AYCHEVDQSA-N |
| XLogP | 3.57 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|