C17H19NO6 — CID 25255228
(3,4,5-trimethoxyphenyl) 3-amino-4-methoxybenzoate (PubChem CID 25255228) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) 3-amino-4-methoxybenzoate.
| Compound Name | (3,4,5-trimethoxyphenyl) 3-amino-4-methoxybenzoate |
|---|---|
| PubChem CID | 25255228 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) 3-amino-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C17H19NO6/c1-20-13-6-5-10(7-12(13)18)17(19)24-11-8-14(21-2)16(23-4)15(9-11)22-3/h5-9H,18H2,1-4H3 |
| InChIKey | MBLXPTFFBUIYFQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|