C26H33ClN4O3S — CID 25256145
N-[4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]butyl]ethanesulfonamide (PubChem CID 25256145) has the molecular formula C26H33ClN4O3S and a molecular weight of 517.10 g/mol. Its IUPAC name is N-[4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]butyl]ethanesulfonamide.
| Compound Name | N-[4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]butyl]ethanesulfonamide |
|---|---|
| PubChem CID | 25256145 |
| Molecular Formula | C26H33ClN4O3S |
| Molecular Weight | 517.10 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]butyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCCCN1CCC[C@@H]1Cn1nc(Cc2ccc(Cl)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C26H33ClN4O3S/c1-2-35(33,34)28-15-5-6-16-30-17-7-8-22(30)19-31-26(32)24-10-4-3-9-23(24)25(29-31)18-20-11-13-21(27)14-12-20/h3-4,9-14,22,28H,2,5-8,15-19H2,1H3/t22-/m1/s1 |
| InChIKey | YOJGSGWWEUHPBC-JOCHJYFZSA-N |
| XLogP | 3.82 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.10 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|