C30H32ClN3O2 — CID 67548540
4-[(4-chlorophenyl)methyl]-2-[[(2S)-1-[4-(4-hydroxyphenyl)butyl]pyrrolidin-2-yl]methyl]phthalazin-1-one (PubChem CID 67548540) has the molecular formula C30H32ClN3O2 and a molecular weight of 502.06 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-[[(2S)-1-[4-(4-hydroxyphenyl)butyl]pyrrolidin-2-yl]methyl]phthalazin-1-one.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-[[(2S)-1-[4-(4-hydroxyphenyl)butyl]pyrrolidin-2-yl]methyl]phthalazin-1-one |
|---|---|
| PubChem CID | 67548540 |
| Molecular Formula | C30H32ClN3O2 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-[[(2S)-1-[4-(4-hydroxyphenyl)butyl]pyrrolidin-2-yl]methyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(Cc2ccc(Cl)cc2)nn1C[C@@H]1CCCN1CCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C30H32ClN3O2/c31-24-14-10-23(11-15-24)20-29-27-8-1-2-9-28(27)30(36)34(32-29)21-25-7-5-19-33(25)18-4-3-6-22-12-16-26(35)17-13-22/h1-2,8-17,25,35H,3-7,18-21H2/t25-/m0/s1 |
| InChIKey | WTQLIYPIJIJTMW-VWLOTQADSA-N |
| XLogP | 5.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|