C28H35ClN4O2 — CID 74374110
N-[3-[2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]propyl]-2,2-dimethylpropanamide (PubChem CID 74374110) has the molecular formula C28H35ClN4O2 and a molecular weight of 495.07 g/mol. Its IUPAC name is N-[3-[2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 74374110 |
| Molecular Formula | C28H35ClN4O2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-[3-[2-[[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]methyl]pyrrolidin-1-yl]propyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCN1CCCC1Cn1nc(Cc2ccc(Cl)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C28H35ClN4O2/c1-28(2,3)27(35)30-15-7-17-32-16-6-8-22(32)19-33-26(34)24-10-5-4-9-23(24)25(31-33)18-20-11-13-21(29)14-12-20/h4-5,9-14,22H,6-8,15-19H2,1-3H3,(H,30,35) |
| InChIKey | AIVQGEIVZVEKCZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|