C19H19NO6S — CID 25257436
5-benzyl-5-ethyl-4-[(4-nitrophenyl)methoxy]oxathiole 2,2-dioxide (PubChem CID 25257436) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is 5-benzyl-5-ethyl-4-[(4-nitrophenyl)methoxy]oxathiole 2,2-dioxide.
| Compound Name | 5-benzyl-5-ethyl-4-[(4-nitrophenyl)methoxy]oxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 25257436 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 5-benzyl-5-ethyl-4-[(4-nitrophenyl)methoxy]oxathiole 2,2-dioxide |
| SMILES | CCC1(Cc2ccccc2)OS(=O)(=O)C=C1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19NO6S/c1-2-19(12-15-6-4-3-5-7-15)18(14-27(23,24)26-19)25-13-16-8-10-17(11-9-16)20(21)22/h3-11,14H,2,12-13H2,1H3 |
| InChIKey | ATZFIGDGYWOVQV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|