C17H21Cl2N5S — CID 25259304
2-[(6-methyl-2-pyridinyl)amino]-N'-propan-2-yl-1,3-benzothiazole-6-carboximidamide;dihydrochloride (PubChem CID 25259304) has the molecular formula C17H21Cl2N5S and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-[(6-methyl-2-pyridinyl)amino]-N'-propan-2-yl-1,3-benzothiazole-6-carboximidamide;dihydrochloride.
| Compound Name | 2-[(6-methyl-2-pyridinyl)amino]-N'-propan-2-yl-1,3-benzothiazole-6-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 25259304 |
| Molecular Formula | C17H21Cl2N5S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-[(6-methyl-2-pyridinyl)amino]-N'-propan-2-yl-1,3-benzothiazole-6-carboximidamide;dihydrochloride |
| SMILES | Cc1cccc(Nc2nc3ccc(/C(N)=N/C(C)C)cc3s2)n1.Cl.Cl |
| InChI | InChI=1S/C17H19N5S.2ClH/c1-10(2)19-16(18)12-7-8-13-14(9-12)23-17(21-13)22-15-6-4-5-11(3)20-15;;/h4-10H,1-3H3,(H2,18,19)(H,20,21,22);2*1H |
| InChIKey | ICEKGLLLRKSGAG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|