C24H36N2O3 — CID 25261607
(3E,4R,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-4-ethyl-10,13-dimethyl-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione (PubChem CID 25261607) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is (3E,4R,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-4-ethyl-10,13-dimethyl-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (3E,4R,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-4-ethyl-10,13-dimethyl-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 25261607 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | (3E,4R,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-4-ethyl-10,13-dimethyl-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-6,17-dione |
| SMILES | CC[C@H]1/C(=N/OC2CNC2)CC[C@@]2(C)C1C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H36N2O3/c1-4-15-19(26-29-14-12-25-13-14)8-10-24(3)18-7-9-23(2)17(5-6-21(23)28)16(18)11-20(27)22(15)24/h14-18,22,25H,4-13H2,1-3H3/b26-19+/t15-,16-,17-,18-,22?,23-,24+/m0/s1 |
| InChIKey | HSSBUUCIHLRBQC-ROXBFXASSA-N |
| XLogP | 3.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|