C24H36N2O4 — CID 25261608
(3E,5S,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-5-hydroxy-4,4,10,13-tetramethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-6,17-dione (PubChem CID 25261608) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is (3E,5S,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-5-hydroxy-4,4,10,13-tetramethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (3E,5S,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-5-hydroxy-4,4,10,13-tetramethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 25261608 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (3E,5S,8R,9S,10R,13S,14S)-3-(azetidin-3-yloxyimino)-5-hydroxy-4,4,10,13-tetramethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-6,17-dione |
| SMILES | CC1(C)/C(=N/OC2CNC2)CC[C@]2(C)[C@H]3CC[C@]4(C)C(=O)CC[C@H]4[C@@H]3CC(=O)[C@@]12O |
| InChI | InChI=1S/C24H36N2O4/c1-21(2)18(26-30-14-12-25-13-14)8-10-23(4)17-7-9-22(3)16(5-6-19(22)27)15(17)11-20(28)24(21,23)29/h14-17,25,29H,5-13H2,1-4H3/b26-18+/t15-,16-,17-,22-,23+,24+/m0/s1 |
| InChIKey | KNGJIOLSQKQSOS-ATPFUBSZSA-N |
| XLogP | 2.87 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|