C24H20N4O2 — CID 25262252
(8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-morpholin-4-ylmethanone (PubChem CID 25262252) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is (8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-morpholin-4-ylmethanone.
| Compound Name | (8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 25262252 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-morpholin-4-ylmethanone |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1)=NCc1c(C(=O)N3CCOCC3)ncn1-2 |
| InChI | InChI=1S/C24H20N4O2/c1-2-17-8-9-20-19(14-17)22(18-6-4-3-5-7-18)25-15-21-23(26-16-28(20)21)24(29)27-10-12-30-13-11-27/h1,3-9,14,16H,10-13,15H2 |
| InChIKey | ROMZPVOWAWUQEI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|