C29H33GeN5O5 — CID 25262963
[(19S)-10-[2-[3-azidopropyl(dimethyl)germyl]ethyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate (PubChem CID 25262963) has the molecular formula C29H33GeN5O5 and a molecular weight of 604.22 g/mol. Its IUPAC name is [(19S)-10-[2-[3-azidopropyl(dimethyl)germyl]ethyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate.
| Compound Name | [(19S)-10-[2-[3-azidopropyl(dimethyl)germyl]ethyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate |
|---|---|
| PubChem CID | 25262963 |
| Molecular Formula | C29H33GeN5O5 |
| Molecular Weight | 604.22 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | [(19S)-10-[2-[3-azidopropyl(dimethyl)germyl]ethyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] acetate |
| SMILES | CC[C@@]1(OC(C)=O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2CC[Ge](C)(C)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C29H33GeN5O5/c1-5-29(40-18(2)36)23-15-25-26-21(16-35(25)27(37)22(23)17-39-28(29)38)19(20-9-6-7-10-24(20)33-26)11-13-30(3,4)12-8-14-32-34-31/h6-7,9-10,15H,5,8,11-14,16-17H2,1-4H3/t29-/m0/s1 |
| InChIKey | YQRUAIUZGUYNAQ-LJAQVGFWSA-N |
| XLogP | 5.60 |
| TPSA | 136.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.22 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|