C26H33F3NO2+ — CID 25267284
2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (PubChem CID 25267284) has the molecular formula C26H33F3NO2+ and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid.
| Compound Name | 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 25267284 |
| Molecular Formula | C26H33F3NO2+ |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(-c2ccc(C(F)(F)F)cc2)cc(C2CC[N+](C)(C)CC2)c1 |
| InChI | InChI=1S/C26H32F3NO2/c1-17(2)13-24(25(31)32)22-15-20(18-5-7-23(8-6-18)26(27,28)29)14-21(16-22)19-9-11-30(3,4)12-10-19/h5-8,14-17,19,24H,9-13H2,1-4H3/p+1 |
| InChIKey | AGHXODITORZDHV-UHFFFAOYSA-O |
| XLogP | 6.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|