C10H12O3 — CID 25268166
(1R,3S,6S,8S,9S)-8-hydroxy-8-methyl-2-methylidene-5-oxatricyclo[4.2.1.03,9]nonan-4-one (PubChem CID 25268166) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (1R,3S,6S,8S,9S)-8-hydroxy-8-methyl-2-methylidene-5-oxatricyclo[4.2.1.03,9]nonan-4-one.
| Compound Name | (1R,3S,6S,8S,9S)-8-hydroxy-8-methyl-2-methylidene-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
|---|---|
| PubChem CID | 25268166 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (1R,3S,6S,8S,9S)-8-hydroxy-8-methyl-2-methylidene-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
| SMILES | C=C1[C@H]2C(=O)O[C@H]3C[C@](C)(O)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C10H12O3/c1-4-6-7-5(13-9(6)11)3-10(2,12)8(4)7/h5-8,12H,1,3H2,2H3/t5-,6+,7+,8-,10-/m0/s1 |
| InChIKey | GREWVQNQDBXPRU-PLAGJLMLSA-N |
| XLogP | 0.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|