C18H30O3 — CID 11011862
ethyl (3R,3aR,6S,6aR)-3-heptyl-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate (PubChem CID 11011862) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is ethyl (3R,3aR,6S,6aR)-3-heptyl-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate.
| Compound Name | ethyl (3R,3aR,6S,6aR)-3-heptyl-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate |
|---|---|
| PubChem CID | 11011862 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | ethyl (3R,3aR,6S,6aR)-3-heptyl-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate |
| SMILES | C=C1C[C@H](C(=O)OCC)[C@@H]2CO[C@H](CCCCCCC)[C@@H]12 |
| InChI | InChI=1S/C18H30O3/c1-4-6-7-8-9-10-16-17-13(3)11-14(15(17)12-21-16)18(19)20-5-2/h14-17H,3-12H2,1-2H3/t14-,15-,16+,17-/m0/s1 |
| InChIKey | FNLVJYLNYYZOIG-NXOAAHMSSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|