C12H14O4 — CID 10775385
(1S,2R,5S,6R,8S)-5-prop-2-enyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione (PubChem CID 10775385) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1S,2R,5S,6R,8S)-5-prop-2-enyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione.
| Compound Name | (1S,2R,5S,6R,8S)-5-prop-2-enyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione |
|---|---|
| PubChem CID | 10775385 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1S,2R,5S,6R,8S)-5-prop-2-enyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione |
| SMILES | C=CC[C@@H]1OC(=O)[C@@H]2[C@H]1C[C@@H]1COC(=O)[C@@H]12 |
| InChI | InChI=1S/C12H14O4/c1-2-3-8-7-4-6-5-15-11(13)9(6)10(7)12(14)16-8/h2,6-10H,1,3-5H2/t6-,7+,8+,9+,10-/m1/s1 |
| InChIKey | BXOLESRLWUTPKK-SQQIUAQRSA-N |
| XLogP | 0.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|