C18H26O4Si — CID 10496967
(1R,2S,5S,6R,8S,9R)-5,9-bis(prop-2-enyl)-7-trimethylsilyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione (PubChem CID 10496967) has the molecular formula C18H26O4Si and a molecular weight of 334.49 g/mol. Its IUPAC name is (1R,2S,5S,6R,8S,9R)-5,9-bis(prop-2-enyl)-7-trimethylsilyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione.
| Compound Name | (1R,2S,5S,6R,8S,9R)-5,9-bis(prop-2-enyl)-7-trimethylsilyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione |
|---|---|
| PubChem CID | 10496967 |
| Molecular Formula | C18H26O4Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (1R,2S,5S,6R,8S,9R)-5,9-bis(prop-2-enyl)-7-trimethylsilyl-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione |
| SMILES | C=CC[C@@H]1OC(=O)[C@H]2[C@H]3C(=O)O[C@H](CC=C)[C@H]3C([Si](C)(C)C)[C@H]21 |
| InChI | InChI=1S/C18H26O4Si/c1-6-8-10-12-14(17(19)21-10)15-13(16(12)23(3,4)5)11(9-7-2)22-18(15)20/h6-7,10-16H,1-2,8-9H2,3-5H3/t10-,11+,12-,13+,14+,15-,16? |
| InChIKey | ODDBZYQUUSCXCK-OEGSFHDBSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|