C15H18O4 — CID 10491712
(1R,2S,5R,6S,8R,9S)-5,9-bis(prop-2-enyl)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione (PubChem CID 10491712) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1R,2S,5R,6S,8R,9S)-5,9-bis(prop-2-enyl)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione.
| Compound Name | (1R,2S,5R,6S,8R,9S)-5,9-bis(prop-2-enyl)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione |
|---|---|
| PubChem CID | 10491712 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1R,2S,5R,6S,8R,9S)-5,9-bis(prop-2-enyl)-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,11-dione |
| SMILES | C=CC[C@@H]1OC(=O)[C@@H]2[C@H]1C[C@H]1[C@@H]2C(=O)O[C@@H]1CC=C |
| InChI | InChI=1S/C15H18O4/c1-3-5-10-8-7-9-11(6-4-2)19-15(17)13(9)12(8)14(16)18-10/h3-4,8-13H,1-2,5-7H2/t8-,9+,10-,11+,12+,13- |
| InChIKey | GYGLTFUWEHYVLE-QOHPJAFVSA-N |
| XLogP | 1.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|