C16H22O4 — CID 58681974
(1S,2R,6R,7R,8R)-2-but-3-enyl-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione (PubChem CID 58681974) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1S,2R,6R,7R,8R)-2-but-3-enyl-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione.
| Compound Name | (1S,2R,6R,7R,8R)-2-but-3-enyl-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
|---|---|
| PubChem CID | 58681974 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S,2R,6R,7R,8R)-2-but-3-enyl-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
| SMILES | C=CCC[C@@]12OC(=O)C[C@@H]1[C@@H](C)[C@@]1(C)C(=O)OC[C@@]21C |
| InChI | InChI=1S/C16H22O4/c1-5-6-7-16-11(8-12(17)20-16)10(2)15(4)13(18)19-9-14(15,16)3/h5,10-11H,1,6-9H2,2-4H3/t10-,11-,14-,15+,16-/m1/s1 |
| InChIKey | MDVKJERBYQCESR-HUEQCLLISA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|