C13H14O4 — CID 98172843
methyl (1R,4S,5S,6R,9R,10S,11R)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylate (PubChem CID 98172843) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is methyl (1R,4S,5S,6R,9R,10S,11R)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylate.
| Compound Name | methyl (1R,4S,5S,6R,9R,10S,11R)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylate |
|---|---|
| PubChem CID | 98172843 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | methyl (1R,4S,5S,6R,9R,10S,11R)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2C=C[C@H]3C[C@H]4OC(=O)[C@H]1[C@H]4[C@H]23 |
| InChI | InChI=1S/C13H14O4/c1-16-12(14)9-6-3-2-5-4-7-10(8(5)6)11(9)13(15)17-7/h2-3,5-11H,4H2,1H3/t5-,6+,7+,8-,9-,10+,11+/m0/s1 |
| InChIKey | WXNHSAHHHSXXEB-BYGIPYRXSA-N |
| XLogP | 0.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|