C23H37FO6 — CID 57143621
5-[(2S,3aR,4S,5R,6aS)-4-(4-fluorooct-1-enyl)-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid (PubChem CID 57143621) has the molecular formula C23H37FO6 and a molecular weight of 428.54 g/mol. Its IUPAC name is 5-[(2S,3aR,4S,5R,6aS)-4-(4-fluorooct-1-enyl)-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid.
| Compound Name | 5-[(2S,3aR,4S,5R,6aS)-4-(4-fluorooct-1-enyl)-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid |
|---|---|
| PubChem CID | 57143621 |
| Molecular Formula | C23H37FO6 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 5-[(2S,3aR,4S,5R,6aS)-4-(4-fluorooct-1-enyl)-5-methoxycarbonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-3-methylpentaneperoxoic acid |
| SMILES | CCCCC(F)CC=C[C@H]1[C@H]2C[C@H](CCC(C)CC(=O)OO)O[C@H]2C[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H37FO6/c1-4-5-7-16(24)8-6-9-18-19-13-17(11-10-15(2)12-22(25)30-27)29-21(19)14-20(18)23(26)28-3/h6,9,15-21,27H,4-5,7-8,10-14H2,1-3H3/t15?,16?,17-,18-,19+,20+,21-/m0/s1 |
| InChIKey | BAFRTSWSFGSIAI-LPOXCYLPSA-N |
| XLogP | 4.87 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|