C23H36FIO6 — CID 22813287
methyl (2S,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-[(1S)-1-iodo-5-methoxy-5-oxopentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate (PubChem CID 22813287) has the molecular formula C23H36FIO6 and a molecular weight of 554.44 g/mol. Its IUPAC name is methyl (2S,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-[(1S)-1-iodo-5-methoxy-5-oxopentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate.
| Compound Name | methyl (2S,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-[(1S)-1-iodo-5-methoxy-5-oxopentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate |
|---|---|
| PubChem CID | 22813287 |
| Molecular Formula | C23H36FIO6 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | methyl (2S,3aR,4S,5R,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-[(1S)-1-iodo-5-methoxy-5-oxopentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate |
| SMILES | CCCC[C@@H](F)[C@H](O)/C=C/[C@H]1[C@H]2C[C@@H]([C@@H](I)CCCC(=O)OC)O[C@H]2C[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H36FIO6/c1-4-5-7-17(24)19(26)11-10-14-15-12-21(18(25)8-6-9-22(27)29-2)31-20(15)13-16(14)23(28)30-3/h10-11,14-21,26H,4-9,12-13H2,1-3H3/b11-10+/t14-,15+,16+,17+,18-,19+,20-,21-/m0/s1 |
| InChIKey | LLESIIBINGWOTP-WGZZWXPUSA-N |
| XLogP | 4.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|