C13H18O4 — CID 166441325
(1R,4S,6R,7S,11S)-8-ethoxy-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-8-en-2-one (PubChem CID 166441325) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1R,4S,6R,7S,11S)-8-ethoxy-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-8-en-2-one.
| Compound Name | (1R,4S,6R,7S,11S)-8-ethoxy-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-8-en-2-one |
|---|---|
| PubChem CID | 166441325 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1R,4S,6R,7S,11S)-8-ethoxy-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-8-en-2-one |
| SMILES | CCOC1=CC[C@H]2C(=O)O[C@H]3C[C@@](C)(O)[C@@H]1[C@H]32 |
| InChI | InChI=1S/C13H18O4/c1-3-16-8-5-4-7-10-9(17-12(7)14)6-13(2,15)11(8)10/h5,7,9-11,15H,3-4,6H2,1-2H3/t7-,9+,10+,11+,13-/m1/s1 |
| InChIKey | VFTXIEUWKNYORW-JOROOKJOSA-N |
| XLogP | 1.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |