C14H20O5 — CID 91228724
5-[(3aR,4R,5R,6aS)-5-hydroxy-4-(2-oxoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid (PubChem CID 91228724) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 5-[(3aR,4R,5R,6aS)-5-hydroxy-4-(2-oxoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid.
| Compound Name | 5-[(3aR,4R,5R,6aS)-5-hydroxy-4-(2-oxoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 91228724 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5-[(3aR,4R,5R,6aS)-5-hydroxy-4-(2-oxoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILES | O=CC[C@@H]1[C@H]2CC(=CCCCC(=O)O)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C14H20O5/c15-6-5-10-11-7-9(3-1-2-4-14(17)18)19-13(11)8-12(10)16/h3,6,10-13,16H,1-2,4-5,7-8H2,(H,17,18)/t10-,11-,12-,13+/m1/s1 |
| InChIKey | CWFWMAIXHIVGFD-LPWJVIDDSA-N |
| XLogP | 1.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|