C19H22O4 — CID 155933436
(1S,4S,6R,7S,11S)-6-hydroxy-6-methyl-10-(2-prop-1-en-2-ylpent-4-ynyl)-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione (PubChem CID 155933436) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1S,4S,6R,7S,11S)-6-hydroxy-6-methyl-10-(2-prop-1-en-2-ylpent-4-ynyl)-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione.
| Compound Name | (1S,4S,6R,7S,11S)-6-hydroxy-6-methyl-10-(2-prop-1-en-2-ylpent-4-ynyl)-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 155933436 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (1S,4S,6R,7S,11S)-6-hydroxy-6-methyl-10-(2-prop-1-en-2-ylpent-4-ynyl)-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione |
| SMILES | C#CCC(CC1=CC(=O)[C@H]2[C@H]3[C@@H]1C(=O)O[C@H]3C[C@@]2(C)O)C(=C)C |
| InChI | InChI=1S/C19H22O4/c1-5-6-11(10(2)3)7-12-8-13(20)17-16-14(9-19(17,4)22)23-18(21)15(12)16/h1,8,11,14-17,22H,2,6-7,9H2,3-4H3/t11?,14-,15+,16+,17-,19+/m0/s1 |
| InChIKey | ZGMYJLMUVIZKAF-AEAIJOCRSA-N |
| XLogP | 2.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|