C21H28O5 — CID 164674481
(1'S,2'S,4'R,10'S,11'R,13'S,16'S)-11'-hydroxy-11'-methyl-4'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-8-ene]-15'-one (PubChem CID 164674481) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1'S,2'S,4'R,10'S,11'R,13'S,16'S)-11'-hydroxy-11'-methyl-4'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-8-ene]-15'-one.
| Compound Name | (1'S,2'S,4'R,10'S,11'R,13'S,16'S)-11'-hydroxy-11'-methyl-4'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-8-ene]-15'-one |
|---|---|
| PubChem CID | 164674481 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1'S,2'S,4'R,10'S,11'R,13'S,16'S)-11'-hydroxy-11'-methyl-4'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-14-oxatetracyclo[8.5.1.02,8.013,16]hexadec-8-ene]-15'-one |
| SMILES | C=C(C)[C@@H]1C[C@@H]2C(=C[C@H]3[C@H]4[C@H]2C(=O)O[C@H]4C[C@@]3(C)O)CC2(C1)OCCO2 |
| InChI | InChI=1S/C21H28O5/c1-11(2)12-6-14-13(9-21(8-12)24-4-5-25-21)7-15-18-16(10-20(15,3)23)26-19(22)17(14)18/h7,12,14-18,23H,1,4-6,8-10H2,2-3H3/t12-,14-,15+,16+,17+,18-,20-/m1/s1 |
| InChIKey | BYHPCYCKXCJHOV-YCDRZAKVSA-N |
| XLogP | 2.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|