C27H24N6O2 — CID 25269147
3-cyano-N-[2-(4-methylpiperazin-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]benzamide (PubChem CID 25269147) has the molecular formula C27H24N6O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 3-cyano-N-[2-(4-methylpiperazin-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]benzamide.
| Compound Name | 3-cyano-N-[2-(4-methylpiperazin-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 25269147 |
| Molecular Formula | C27H24N6O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-cyano-N-[2-(4-methylpiperazin-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(-c3n[nH]c(=O)c4ccccc34)cc2NC(=O)c2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C27H24N6O2/c1-32-11-13-33(14-12-32)24-10-9-19(25-21-7-2-3-8-22(21)27(35)31-30-25)16-23(24)29-26(34)20-6-4-5-18(15-20)17-28/h2-10,15-16H,11-14H2,1H3,(H,29,34)(H,31,35) |
| InChIKey | PYROIVLMTIYTDD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |