C13H13FN2O2 — CID 2526936
N-[(2-fluorophenyl)-(prop-2-enoylamino)methyl]prop-2-enamide (PubChem CID 2526936) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is N-[(2-fluorophenyl)-(prop-2-enoylamino)methyl]prop-2-enamide.
| Compound Name | N-[(2-fluorophenyl)-(prop-2-enoylamino)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 2526936 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-[(2-fluorophenyl)-(prop-2-enoylamino)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(NC(=O)C=C)c1ccccc1F |
| InChI | InChI=1S/C13H13FN2O2/c1-3-11(17)15-13(16-12(18)4-2)9-7-5-6-8-10(9)14/h3-8,13H,1-2H2,(H,15,17)(H,16,18) |
| InChIKey | XEOGQVWSGSNAAT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|