C24H21N3O4S — CID 2527054
N-[(2-oxoacenaphthylen-1-ylidene)amino]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 2527054) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[(2-oxoacenaphthylen-1-ylidene)amino]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(2-oxoacenaphthylen-1-ylidene)amino]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2527054 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[(2-oxoacenaphthylen-1-ylidene)amino]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NN=C1C(=O)c2cccc3cccc1c23)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H21N3O4S/c28-23-20-12-6-8-16-7-5-11-19(21(16)20)22(23)25-26-24(29)17-9-4-10-18(15-17)32(30,31)27-13-2-1-3-14-27/h4-12,15H,1-3,13-14H2,(H,26,29) |
| InChIKey | ZGIIVAGQVNVVSE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|