C21H29N3O3S — CID 3552045
N-[(2-pentylcyclopent-2-en-1-ylidene)amino]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 3552045) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[(2-pentylcyclopent-2-en-1-ylidene)amino]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(2-pentylcyclopent-2-en-1-ylidene)amino]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3552045 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[(2-pentylcyclopent-2-en-1-ylidene)amino]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCCCCC1=CCCC1=NNC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H29N3O3S/c1-2-3-4-9-17-10-8-13-20(17)22-23-21(25)18-11-7-12-19(16-18)28(26,27)24-14-5-6-15-24/h7,10-12,16H,2-6,8-9,13-15H2,1H3,(H,23,25) |
| InChIKey | KSEOHOQIPKSGGN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|