C50H46N2O4 — CID 25270681
4-[(E)-2-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]ethenyl]-1-tritylimidazole (PubChem CID 25270681) has the molecular formula C50H46N2O4 and a molecular weight of 738.93 g/mol. Its IUPAC name is 4-[(E)-2-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]ethenyl]-1-tritylimidazole.
| Compound Name | 4-[(E)-2-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]ethenyl]-1-tritylimidazole |
|---|---|
| PubChem CID | 25270681 |
| Molecular Formula | C50H46N2O4 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.35 |
| IUPAC Name | 4-[(E)-2-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]ethenyl]-1-tritylimidazole |
| SMILES | C(=C/[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1)\c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C50H46N2O4/c1-7-19-39(20-8-1)34-53-37-47-49(55-36-41-23-11-3-12-24-41)48(54-35-40-21-9-2-10-22-40)46(56-47)32-31-45-33-52(38-51-45)50(42-25-13-4-14-26-42,43-27-15-5-16-28-43)44-29-17-6-18-30-44/h1-33,38,46-49H,34-37H2/b32-31+/t46-,47+,48-,49+/m0/s1 |
| InChIKey | VAKNHERYXIFHKW-GLBDKELDSA-N |
| XLogP | 9.89 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|