C44H47NO5 — CID 102091536
(E)-N-benzyl-3-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-en-1-amine (PubChem CID 102091536) has the molecular formula C44H47NO5 and a molecular weight of 669.86 g/mol. Its IUPAC name is (E)-N-benzyl-3-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-en-1-amine.
| Compound Name | (E)-N-benzyl-3-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 102091536 |
| Molecular Formula | C44H47NO5 |
| Molecular Weight | 669.86 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | (E)-N-benzyl-3-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-en-1-amine |
| SMILES | C(=C/[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)\CNCc1ccccc1 |
| InChI | InChI=1S/C44H47NO5/c1-6-17-35(18-7-1)29-45-28-16-27-40-42(47-31-37-21-10-3-11-22-37)44(49-33-39-25-14-5-15-26-39)43(48-32-38-23-12-4-13-24-38)41(50-40)34-46-30-36-19-8-2-9-20-36/h1-27,40-45H,28-34H2/b27-16+/t40-,41+,42-,43+,44+/m0/s1 |
| InChIKey | AJGLNDWTHDOSBD-YPMYWZELSA-N |
| XLogP | 8.07 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.86 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|