C17H26O2 — CID 25271370
tert-butyl (Z)-3-methyl-4-[(1R,2S,4R,5S)-3-tricyclo[3.2.1.02,4]octanyl]but-3-enoate (PubChem CID 25271370) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is tert-butyl (Z)-3-methyl-4-[(1R,2S,4R,5S)-3-tricyclo[3.2.1.02,4]octanyl]but-3-enoate.
| Compound Name | tert-butyl (Z)-3-methyl-4-[(1R,2S,4R,5S)-3-tricyclo[3.2.1.02,4]octanyl]but-3-enoate |
|---|---|
| PubChem CID | 25271370 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | tert-butyl (Z)-3-methyl-4-[(1R,2S,4R,5S)-3-tricyclo[3.2.1.02,4]octanyl]but-3-enoate |
| SMILES | C/C(=C/C1[C@@H]2[C@H]3CC[C@H](C3)[C@H]12)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26O2/c1-10(8-14(18)19-17(2,3)4)7-13-15-11-5-6-12(9-11)16(13)15/h7,11-13,15-16H,5-6,8-9H2,1-4H3/b10-7-/t11-,12+,13?,15-,16+ |
| InChIKey | XFGYOPQLYOWTTC-XDODGXGBSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|