C19H18N2O2S — CID 2528625
N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 2528625) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2528625 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | CCOc1ccc2nc(NC(=O)C3(c4ccccc4)CC3)sc2c1 |
| InChI | InChI=1S/C19H18N2O2S/c1-2-23-14-8-9-15-16(12-14)24-18(20-15)21-17(22)19(10-11-19)13-6-4-3-5-7-13/h3-9,12H,2,10-11H2,1H3,(H,20,21,22) |
| InChIKey | MIZRKKAOAXWGPM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |