C14H14Cl2N2O2S — CID 46665582
2,2-dichloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-methylcyclopropane-1-carboxamide (PubChem CID 46665582) has the molecular formula C14H14Cl2N2O2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 2,2-dichloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46665582 |
| Molecular Formula | C14H14Cl2N2O2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2,2-dichloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CCOc1ccc2nc(NC(=O)C3(C)CC3(Cl)Cl)sc2c1 |
| InChI | InChI=1S/C14H14Cl2N2O2S/c1-3-20-8-4-5-9-10(6-8)21-12(17-9)18-11(19)13(2)7-14(13,15)16/h4-6H,3,7H2,1-2H3,(H,17,18,19) |
| InChIKey | LMDAXLOHFIQVLK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|