C21H19FN4O4 — CID 25290649
methyl 3-[[(3-fluorobenzoyl)amino]methyl]-5-[(2-pyrazol-1-ylacetyl)amino]benzoate (PubChem CID 25290649) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is methyl 3-[[(3-fluorobenzoyl)amino]methyl]-5-[(2-pyrazol-1-ylacetyl)amino]benzoate.
| Compound Name | methyl 3-[[(3-fluorobenzoyl)amino]methyl]-5-[(2-pyrazol-1-ylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 25290649 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | methyl 3-[[(3-fluorobenzoyl)amino]methyl]-5-[(2-pyrazol-1-ylacetyl)amino]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2cccc(F)c2)cc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C21H19FN4O4/c1-30-21(29)16-8-14(12-23-20(28)15-4-2-5-17(22)10-15)9-18(11-16)25-19(27)13-26-7-3-6-24-26/h2-11H,12-13H2,1H3,(H,23,28)(H,25,27) |
| InChIKey | VTAZVFNYDBCFLU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |