C27H21FN4O4 — CID 42355828
methyl 3-[[[3-(3-fluorophenyl)benzoyl]amino]methyl]-5-(pyrazine-2-carbonylamino)benzoate (PubChem CID 42355828) has the molecular formula C27H21FN4O4 and a molecular weight of 484.49 g/mol. Its IUPAC name is methyl 3-[[[3-(3-fluorophenyl)benzoyl]amino]methyl]-5-(pyrazine-2-carbonylamino)benzoate.
| Compound Name | methyl 3-[[[3-(3-fluorophenyl)benzoyl]amino]methyl]-5-(pyrazine-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 42355828 |
| Molecular Formula | C27H21FN4O4 |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | methyl 3-[[[3-(3-fluorophenyl)benzoyl]amino]methyl]-5-(pyrazine-2-carbonylamino)benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2cccc(-c3cccc(F)c3)c2)cc(NC(=O)c2cnccn2)c1 |
| InChI | InChI=1S/C27H21FN4O4/c1-36-27(35)21-10-17(11-23(14-21)32-26(34)24-16-29-8-9-30-24)15-31-25(33)20-6-2-4-18(12-20)19-5-3-7-22(28)13-19/h2-14,16H,15H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | ARUOPIZBHPDANT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |