C24H21N3O4 — CID 42367388
methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate (PubChem CID 42367388) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate.
| Compound Name | methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate |
|---|---|
| PubChem CID | 42367388 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(pyridine-2-carbonylamino)methyl]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2ccccn2)cc(NC(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C24H21N3O4/c1-31-24(30)19-13-18(16-26-23(29)21-9-5-6-12-25-21)14-20(15-19)27-22(28)11-10-17-7-3-2-4-8-17/h2-15H,16H2,1H3,(H,26,29)(H,27,28)/b11-10+ |
| InChIKey | BBNPEBDOHUKCMX-ZHACJKMWSA-N |
| XLogP | 3.45 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|