C28H25N5O4 — CID 74501625
methyl 3-(3-phenylprop-2-enoylamino)-5-[[[2-(3-phenyl-1H-1,2,4-triazol-5-yl)acetyl]amino]methyl]benzoate (PubChem CID 74501625) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is methyl 3-(3-phenylprop-2-enoylamino)-5-[[[2-(3-phenyl-1H-1,2,4-triazol-5-yl)acetyl]amino]methyl]benzoate.
| Compound Name | methyl 3-(3-phenylprop-2-enoylamino)-5-[[[2-(3-phenyl-1H-1,2,4-triazol-5-yl)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 74501625 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | methyl 3-(3-phenylprop-2-enoylamino)-5-[[[2-(3-phenyl-1H-1,2,4-triazol-5-yl)acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)Cc2nc(-c3ccccc3)n[nH]2)cc(NC(=O)C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H25N5O4/c1-37-28(36)22-14-20(15-23(16-22)30-25(34)13-12-19-8-4-2-5-9-19)18-29-26(35)17-24-31-27(33-32-24)21-10-6-3-7-11-21/h2-16H,17-18H2,1H3,(H,29,35)(H,30,34)(H,31,32,33) |
| InChIKey | WDSIZQCMKPTJEP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|