C26H29N3O5S — CID 25296208
methyl 3-[(4-acetamidophenyl)methyl]-7-oxo-9-(2-thiophen-3-ylethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate (PubChem CID 25296208) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is methyl 3-[(4-acetamidophenyl)methyl]-7-oxo-9-(2-thiophen-3-ylethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate.
| Compound Name | methyl 3-[(4-acetamidophenyl)methyl]-7-oxo-9-(2-thiophen-3-ylethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
|---|---|
| PubChem CID | 25296208 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | methyl 3-[(4-acetamidophenyl)methyl]-7-oxo-9-(2-thiophen-3-ylethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
| SMILES | COC(=O)c1c(OCCc2ccsc2)cc(=O)n2c1CCN(Cc1ccc(NC(C)=O)cc1)CC2 |
| InChI | InChI=1S/C26H29N3O5S/c1-18(30)27-21-5-3-19(4-6-21)16-28-10-7-22-25(26(32)33-2)23(15-24(31)29(22)12-11-28)34-13-8-20-9-14-35-17-20/h3-6,9,14-15,17H,7-8,10-13,16H2,1-2H3,(H,27,30) |
| InChIKey | SLGOICWATGKAAK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |