C25H26N2O5S2 — CID 42248254
methyl 3-[2-(4-methylsulfanylphenyl)acetyl]-7-oxo-9-(thiophen-3-ylmethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate (PubChem CID 42248254) has the molecular formula C25H26N2O5S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is methyl 3-[2-(4-methylsulfanylphenyl)acetyl]-7-oxo-9-(thiophen-3-ylmethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate.
| Compound Name | methyl 3-[2-(4-methylsulfanylphenyl)acetyl]-7-oxo-9-(thiophen-3-ylmethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
|---|---|
| PubChem CID | 42248254 |
| Molecular Formula | C25H26N2O5S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | methyl 3-[2-(4-methylsulfanylphenyl)acetyl]-7-oxo-9-(thiophen-3-ylmethoxy)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
| SMILES | COC(=O)c1c(OCc2ccsc2)cc(=O)n2c1CCN(C(=O)Cc1ccc(SC)cc1)CC2 |
| InChI | InChI=1S/C25H26N2O5S2/c1-31-25(30)24-20-7-9-26(22(28)13-17-3-5-19(33-2)6-4-17)10-11-27(20)23(29)14-21(24)32-15-18-8-12-34-16-18/h3-6,8,12,14,16H,7,9-11,13,15H2,1-2H3 |
| InChIKey | BGQGJJPSLJNXIZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |