C25H25FN2O5S — CID 42449704
methyl 9-[2-(2-fluorophenyl)ethoxy]-7-oxo-3-(2-thiophen-3-ylacetyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate (PubChem CID 42449704) has the molecular formula C25H25FN2O5S and a molecular weight of 484.55 g/mol. Its IUPAC name is methyl 9-[2-(2-fluorophenyl)ethoxy]-7-oxo-3-(2-thiophen-3-ylacetyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate.
| Compound Name | methyl 9-[2-(2-fluorophenyl)ethoxy]-7-oxo-3-(2-thiophen-3-ylacetyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
|---|---|
| PubChem CID | 42449704 |
| Molecular Formula | C25H25FN2O5S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | methyl 9-[2-(2-fluorophenyl)ethoxy]-7-oxo-3-(2-thiophen-3-ylacetyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
| SMILES | COC(=O)c1c(OCCc2ccccc2F)cc(=O)n2c1CCN(C(=O)Cc1ccsc1)CC2 |
| InChI | InChI=1S/C25H25FN2O5S/c1-32-25(31)24-20-6-9-27(22(29)14-17-8-13-34-16-17)10-11-28(20)23(30)15-21(24)33-12-7-18-4-2-3-5-19(18)26/h2-5,8,13,15-16H,6-7,9-12,14H2,1H3 |
| InChIKey | VLAQRDAOSJQXBB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |