C21H20N2O — CID 25307295
N-[(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)methyl]-N-prop-2-ynylprop-2-en-1-amine (PubChem CID 25307295) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)methyl]-N-prop-2-ynylprop-2-en-1-amine.
| Compound Name | N-[(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)methyl]-N-prop-2-ynylprop-2-en-1-amine |
|---|---|
| PubChem CID | 25307295 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)methyl]-N-prop-2-ynylprop-2-en-1-amine |
| SMILES | C#CCN(CC=C)Cc1nc(-c2ccc3ccccc3c2)oc1C |
| InChI | InChI=1S/C21H20N2O/c1-4-12-23(13-5-2)15-20-16(3)24-21(22-20)19-11-10-17-8-6-7-9-18(17)14-19/h1,5-11,14H,2,12-13,15H2,3H3 |
| InChIKey | ZHXLHPKEBLGUQW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|