About 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one
1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one (PubChem CID 2531014) has the molecular formula C23H17N3O2
and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one.
Molecular Properties
| Compound Name | 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one |
| PubChem CID | 2531014 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one |
| SMILES | CN1C(=O)C(=NN=C(C(=O)c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H17N3O2/c1-26-19-15-9-8-14-18(19)21(23(26)28)25-24-20(16-10-4-2-5-11-16)22(27)17-12-6-3-7-13-17/h2-15H,1H3 |
| InChIKey | YENSBYHYOZMMJC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one?
The IUPAC name of 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one (CID 2531014) is 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one.
What is the SMILES notation for 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one?
The canonical SMILES for 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one is CN1C(=O)C(=NN=C(C(=O)c2ccccc2)c2ccccc2)c2ccccc21.
What is the InChIKey of 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one?
The InChIKey is YENSBYHYOZMMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O2/c1-26-19-15-9-8-14-18(19)21(23(26)28)25-24-20(16-10-4-2-5-11-16)22(27)17-12-6-3-7-13-17/h2-15H,1H3.
What are the key properties of 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one?
1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one has a molecular weight of 367.41 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]indol-2-one is sourced from PubChem (CID 2531014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).