C22H23N3O2 — CID 49147402
1-[4-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]piperidin-1-yl]propan-1-one (PubChem CID 49147402) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-[4-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 49147402 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-[4-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC(=N/N=C(/C(=O)c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23N3O2/c1-2-20(26)25-15-13-19(14-16-25)23-24-21(17-9-5-3-6-10-17)22(27)18-11-7-4-8-12-18/h3-12H,2,13-16H2,1H3/b24-21+ |
| InChIKey | XVBHWJDXQITZSL-DARPEHSRSA-N |
| XLogP | 3.75 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|