C17H23N3O2S2 — CID 25312969
N-[[2-(azocan-1-yl)-3-pyridinyl]methyl]thiophene-3-sulfonamide (PubChem CID 25312969) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[[2-(azocan-1-yl)-3-pyridinyl]methyl]thiophene-3-sulfonamide.
| Compound Name | N-[[2-(azocan-1-yl)-3-pyridinyl]methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 25312969 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[[2-(azocan-1-yl)-3-pyridinyl]methyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCc1cccnc1N1CCCCCCC1)c1ccsc1 |
| InChI | InChI=1S/C17H23N3O2S2/c21-24(22,16-8-12-23-14-16)19-13-15-7-6-9-18-17(15)20-10-4-2-1-3-5-11-20/h6-9,12,14,19H,1-5,10-11,13H2 |
| InChIKey | PBDWNQYGRJLQMG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |