C22H20N2O3S — CID 2531702
[2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-phenylsulfanylpyridine-3-carboxylate (PubChem CID 2531702) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-phenylsulfanylpyridine-3-carboxylate.
| Compound Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-phenylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 2531702 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-phenylsulfanylpyridine-3-carboxylate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)c2cccnc2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-16-9-11-17(12-10-16)14-24-20(25)15-27-22(26)19-8-5-13-23-21(19)28-18-6-3-2-4-7-18/h2-13H,14-15H2,1H3,(H,24,25) |
| InChIKey | KEOBSZKPVBZAPX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |